2,6-Dichloropurine riboside is a purine nucleoside analog consisting of a ribose sugar moiety and a 2,6-dichloropurine base. It serves as a key building block in the synthesis of various nucleoside analogue pharmaceuticals.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13276-52-3
2-Chloroadenosine
adenosine receptor agonist
2-Amino-6-chloropurine riboside
pharmaceutical intermediate for nucleotide synthesis
2-Chloro-9-pentofuranosyl-9H-purin-6-amine--water (1/1)
Nucleoside analog research reagent
Ethyl (4-(3-oxomorpholino)phenyl)carbamate
pharmaceutical intermediate
2-((3-Chlorophenyl)amino)benzoic acid
pharmaceutical intermediate
4-Chloro-2,5-difluorobenzoic acid
Pharmaceutical intermediate
2-Chloro-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
pharmaceutical intermediate
(2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
HJXWZGVMHDPCRS-UUOKFMHZSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2Cl)Cl