tert-Butyl L-valinate is the tert-butyl ester of the amino acid L-valine. It is commonly used as a research compound in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13211-31-9
4,4'-Bipyridyl-d8
deuterated analytical reference standard
4-Methoxyhippuric acid
biochemical research reagent
Dotap chloride
cationic lipid transfection reagent
5-Cyano-2-methylindole-3-acetic acid
indole derivative research compound
H-D-Val-OtBu hydrochloride
Pharmaceutical intermediate for peptide synthesis
tert-butyl (2S)-2-amino-3-methylbutanoate
RJBVJBGFJIHJSZ-ZETCQYMHSA-N
CC(C)[C@@H](C(=O)OC(C)(C)C)N