This compound is a chiral piperazine derivative with a tert-butyl ester protecting group. It is primarily used as a building block in the synthesis of more complex molecules for pharmaceutical research and development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 129779-30-2
Ethyl Piperazine-2-carboxylate Dihydrochloride
Pharmaceutical intermediate
1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-methyl 1,2-piperazinedicarboxylate
pharmaceutical intermediate for synthesis
(1r,2s,3s,4r,5s)-1-(acetoxymethyl)-5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate
pharmaceutical intermediate
tert-butyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate
NUZXPHIQZUYMOR-DTORHVGOSA-N
C[C@@H]1CN(C[C@@H](N1)C)C(=O)OC(C)(C)C