Ac-D-2Nal-D-Phe(4-Cl)-D-3Pal-OH is a synthetic peptide compound consisting of three D-amino acid residues with an acetylated N-terminus. It is used as a research reagent in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 129225-22-5
(3R,8S,9S,12R)-Atazanavir
reference standard impurity
5,8-DIOXA-10-AZADISPIRO[2.0.4.3]UNDECANE
Research reagent for heterocyclic chemistry
5-methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid
research compound
2-chloro-5,6,7,8-tetrahydroquinolin-8-one
research compound
(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoic acid
UELARIGGXWXYRN-MPFGFTFXSA-N
CC(=O)N[C@H](CC1=CC2=CC=CC=C2C=C1)C(=O)N[C@H](CC3=CC=C(C=C3)Cl)C(=O)N[C@H](CC4=CN=CC=C4)C(=O)O