This compound is a pyridine-based aldehyde containing iodine and trifluoromethyl substituents. It is used as a research reagent in organic synthesis and medicinal chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1289045-37-9
6-Hydroxy-5-(trifluoromethyl)nicotinaldehyde
research compound
4-fluoro-2-methylamino-benzoic Acid
research compound
Tert-butyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate
research compound
Rac-tert-butyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate
research compound
5-iodo-3-(trifluoromethyl)pyridine-2-carbaldehyde
QNQIUINGZVTNEY-UHFFFAOYSA-N
C1=C(C=NC(=C1C(F)(F)F)C=O)I
—