3-Bromo-5-chlorobiphenyl is a polychlorinated biphenyl (PCB) analog used primarily as a research chemical intermediate. Its structure contains two aromatic rings and two halogen substituents, making it a model compound for studying environmental fate or metabolic pathways.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 126866-35-1
Stearalkonium hectorite
Rheology modifier in cosmetics
1-Chloro-2-propanol
Chemical intermediate for propylene oxide
Acetone oxime
solvent for cellulose ethers
Sodyum asetat
Buffer and electroplating agent
1-bromo-3-chloro-5-phenylbenzene
SJLJTKRBBCLGPR-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)Cl