Atorvastatin Acetonide tert-Butyl Ester is a chemical compound used as an intermediate in the manufacturing of atorvastatin, a statin medication. It features a complex structure incorporating a pyrrole ring, acetonide protecting group, and tert-butyl ester moiety.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 125971-95-1
2-(2-(4-fluorophenyl)-2-oxo-1-phenylethyl)-4-methyl-3-oxo-N-phenylpentanamide
pharmaceutical intermediate
(4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate
Atorvastatin Intermediate
Di-tert-butyl (R)-4-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for synthesis
(R)-2-AMINO-4-(NAPHTHALEN-1-YL)BUTANOIC ACID
Pharmaceutical intermediate for agomelatine impurities
tert-butyl 2-[(4R,6R)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate
NPPZOMYSGNZDKY-ROJLCIKYSA-N
CC(C)C1=C(C(=C(N1CC[C@@H]2C[C@@H](OC(O2)(C)C)CC(=O)OC(C)(C)C)C3=CC=C(C=C3)F)C4=CC=CC=C4)C(=O)NC5=CC=CC=C5