This compound is a protected amino acid derivative, specifically a tert-butoxycarbonyl (Boc)-protected form of D-tert-butylglycine. It is primarily used as a building block in peptide synthesis, where the protecting groups facilitate controlled formation of peptide bonds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 124655-17-0
3-methylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
(1S,4R)-4-(2-Amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-carboxylate
Impurity of abacavir synthesis
2-(4-ethylphenyl)-2-methylpropanoic acid
Pharmaceutical intermediate
5-(4'-(Bromomethyl)(1,1'-biphenyl)-2-yl)-1-trityl-1h-tetraazole
pharmaceutical intermediate
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-ZETCQYMHSA-N
CC(C)(C)[C@H](C(=O)O)NC(=O)OC(C)(C)C