4-Aminocyclohexanol-d10 is a deuterated research compound where all hydrogen atoms on the cyclohexane ring are replaced by deuterium, incorporating both an amino and a hydroxyl functional group. It is primarily used as an analytical standard or labeled reagent in chemical and biological research to study metabolic pathways or reaction mechanisms.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1241045-80-6
MMP-inhibitor I
matrix metalloproteinase inhibitor
Enzalutamide metabolite M5
research compound
Methyl 5-bromo-3-hydroxypicolinate
research chemical intermediate
5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester
research compound
4-Aminocyclohexanol
research compound for testicular atrophy studies
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
intermediate for ambroxol impurity synthesis
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
pharmaceutical intermediate
4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol
IMLXLGZJLAOKJN-MBXGXEIXSA-N
[2H]C1(C(C(C(C(C1([2H])N)([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H]