Seco-DUBA is a chemical compound characterized by the presence of multiple amide, aromatic, and heterocyclic groups, along with a halogen atom, giving it a specific ring-containing and moderately polar structure. It is primarily recognized as a research reagent used in the context of antibody-drug conjugate development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1227961-59-2
MAC glucuronide phenol-linked SN-38
antibody-drug conjugate payload
4-pyridin-2-yloxycyclohexane-1-carbohydrazide
research compound
Cimaterol D7
deuterated analytical reference standard
4-bromophenylalanine hydrochloride
research compound
(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-ethylphenyl)propanoic acid
research compound for peptide synthesis
N-[2-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]imidazo[1,2-a]pyridin-6-yl]-4-hydroxybenzamide
VQAFBYLFRCCWNB-GOSISDBHSA-N
CC1=C2C(=CC=C1)C(=CC3=C2[C@@H](CN3C(=O)C4=CN5C=C(C=CC5=N4)NC(=O)C6=CC=C(C=C6)O)CCl)O