This compound is a chemical compound with a pyrrolidine ring and a tert-butoxycarbonyl (Boc) protecting group, commonly employed as a pharmaceutical intermediate. Its structure features a stereocenter, making it useful in the synthesis of enantiomerically pure compounds for drug development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 122536-76-9
3-(boc-amino)piperidine
Pharmaceutical intermediate
Tert-butyl N-[(3S)-piperidin-3-yl]carbamate
pharmaceutical intermediate
(3R)-3-Aminopiperidine, 3-BOC protected
Pharmaceutical intermediate for API synthesis
Tert-butyl N-[(3R)-piperidin-3-yl]carbamate hydrochloride
research compound
(S)-3-Hydroxypyrrolidine hydrochloride
Pharmaceutical intermediate
4,4-Difluorocyclohexanecarboxylic acid
Pharmaceutical intermediate synthesis
1-tert-butyl 3-methyl pyrrolidine-1,3-dicarboxylate
Pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-N'-methylethylenediamine
Pharmaceutical intermediate
tert-butyl N-[(3S)-pyrrolidin-3-yl]carbamate
DQQJBEAXSOOCPG-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@H]1CCNC1