Methyl 5-Bromo-2-methoxynicotinate is a chemical compound used primarily as a research reagent. It is a functionalized pyridine derivative bearing ester, ether, and halogen groups, commonly employed in laboratory-scale organic synthesis and medicinal chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 122433-41-4
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
Cyclooctene;iridium;dichloride
organoiridium catalyst precursor
(2S)-2-((2-(2-(2-(2-(2-(2-(2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethylamino)-2-oxoethoxy)acetyl)amino)-N-(4-(hydroxymethyl)phenyl)-6-(((4-methoxyphenyl)-diphenylmethyl)amino)hexanamide
PEGylated bifunctional linker reagent
(9,9-Diphenyl-9H-fluoren-4-yl)boronic acid
research compound
6-chloro-5-fluoro-1H-indole
research compound
methyl 5-bromo-2-methoxypyridine-3-carboxylate
OLQOVEOEHQDKSC-UHFFFAOYSA-N
COC1=C(C=C(C=N1)Br)C(=O)OC
—