Monoethyl Phthalate-d4 is a deuterium-labeled research reference standard used in analytical chemistry and environmental testing. It is the isotopically substituted form of monoethyl phthalate, with four hydrogen atoms replaced by deuterium, making it valuable for quantification and tracing studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1219806-03-7
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
Dodecanoic-d23 acid
isotopically labeled research reference standard
3,4-Dihydroxyphenylacetic Acid-d5
isotopically labeled research reference standard
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
Pyrazine-2,5-dicarboxylic acid
research compound
Tert-Butyldicyclohexylphosphonium tetrafluoroborate
phosphine ligand precursor
2-(2-Fluorophenyl)-3H-imidazo[4,5-c]pyridine methanesulfonate
research compound
2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid
YWWHKOHZGJFMIE-LNFUJOGGSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC)[2H])[2H]