3,5-Dichlorobenzoic-d3 Acid is a deuterated research reagent, specifically the isotopically labeled form of 3,5-dichlorobenzoic acid where three hydrogen atoms are replaced with deuterium. This compound is used in analytical and synthetic chemistry for tracing and mechanistic studies, leveraging its stable isotope labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1219803-99-2
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2,2-Dimethylbutanoic acid-d11
deuterated research reagent
2-[Bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide
deuterated reference standard
1,5-PENTANE-D10-DIOL
Deuterated research reagent
3,5-DICHLOROBENZOIC ACID
herbicide and metabolite
3,5-dichloro-2,4,6-trideuteriobenzoic acid
CXKCZFDUOYMOOP-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])Cl)[2H])C(=O)O