This compound is a deuterated research standard, specifically a pentyl ester of 4-hydroxybenzoic acid where the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a labeled reference compound in analytical chemistry and mass spectrometry for quantification or tracing studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1219798-66-9
N-butyl 4-hydroxybenzoate-2,3,5,6-d4
cosmetic preservative
N-propyl 4-hydroxybenzoate-2,3,5,6-d4
Preservative in cosmetics and personal care
3,4-difluorobenzoic-d3 acid
research compound
4-Methoxyphenyl-2,3,5,6-d4-acetonitrile
deuterated research compound
1,2-Phenylenediamine-d8
deuterium-labeled research compound
2,4-Difluorotoluene-3,5,6-d3
deuterium-labeled research compound
pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate
ZNSSPLQZSUWFJT-KDWZCNHSSA-N
[2H]C1=C(C(=C(C(=C1C(=O)OCCCCC)[2H])[2H])O)[2H]