DPPF (1,1'-bis(diphenylphosphino)ferrocene) is a research reagent primarily used as an ionophore in chemical sensing applications. Its structure features a ferrocene backbone with two diphenylphosphino groups, enabling selective ion binding and detection.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 12150-46-8
(1,1'-Bis(diphenylphosphino)ferrocene)dichloropalladium
palladium catalyst for cross-coupling reactions
[1,1'-Bis(diphenylphosphino)ferrocene]palladium(II) chloride dichloromethane complex
Cross-coupling catalyst in organic synthesis
(r)-4-(trimethylsilyl)-3-butyn-2-ol
research chemical
Midazolam 2,5-Dioxide-d6
deuterated analytical reference standard
N-Acetyl Sulfamethoxazole-d4 (major)
Research compound for metabolite analysis
Zolpidem-d6 6-Carboxylic Acid Methyl Ester
research compound
bis(cyclopenta-1,4-dien-1-yl(diphenyl)phosphane);iron(2+)
KZPYGQFFRCFCPP-UHFFFAOYSA-N
[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Fe+2]