Methyl 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylate is a pyridine-based compound used as a research chemical intermediate. Its structure features an ester group and halogen substituents, making it suitable for laboratory synthesis and development of complex organic molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1214328-84-3
Methyl 5-bromo-6-methoxypicolinate
research compound
6-Bromo-2-fluoropyridine-3-carboxylic acid
research compound
Methyl 5-chloro-3-(trifluoromethyl)picolinate
heterocyclic research compound
5-fluoro-2-hydroxy-3-(trifluoromethyl)pyridine
research compound
methyl 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylate
YRYMNZJJAFOWHH-UHFFFAOYSA-N
COC(=O)C1=C(C=C(C=N1)Br)C(F)(F)F
—