This compound is a chiral amino alcohol derivative bearing a 4-chlorophenyl substituent, typically supplied as a research reagent. Its structure includes an aromatic ring, an alcohol group, and an amine group, contributing to its use in laboratory investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1213362-28-7
Palladium hydroxide
Catalyst for hydrogenolysis reactions
(7-Bromo-9,9-dimethyl-9H-fluoren-2-yl)boronic Acid (contains varying amounts of Anhydride)
organic synthesis intermediate
2'-Hydroxychalcone
research compound
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
Boron reagent for cross-coupling
(3s)-3-amino-3-(4-chlorophenyl)propan-1-ol
research compound
(3R)-3-amino-3-(4-chlorophenyl)propan-1-ol
JGNACDMQJLVKIU-SECBINFHSA-N
C1=CC(=CC=C1[C@@H](CCO)N)Cl
—