(4-Pentylphenyl)boronic acid is a boronic acid derivative featuring a pentyl-substituted phenyl ring. It is commonly employed as a research reagent, particularly in organic synthesis and cross-coupling reactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 121219-12-3
(4-heptylphenyl)boronic Acid
n.a
4-Butylphenylboronic acid
research chemical and synthetic intermediate
(4-propylphenyl)boronic Acid
Boronic acid reagent for organic synthesis
2,3-Difluorophenylboronic acid
research compound
P-(octyloxyphenyl)phenyliodonium hexafluoroantimonate
photoacid generator for polymerizations
Dplgltaa
fluorogenic substrate for collagenase
Bis[cinnamyl palladium(II) chloride]
organometallic catalyst precursor
(4-pentylphenyl)boronic acid
UZRMPSOGFATLJE-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CCCCC)(O)O