Tert-butyl 4-iodobenzoate is an organic compound featuring an aromatic ring substituted with an iodine atom and a tert-butyl ester group. It is primarily used as a research chemical intermediate in laboratory synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 120363-13-5
3-[(4-Chlorophenyl)methoxy]-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide
Research compound
2,7-Diazaspiro[4.4]nonan-1-one hydrochloride
research compound
1,7-diazaspiro[4.4]nonan-6-one hydrochloride
research compound
20-Hydroxy-3,6,9,12,15,18-hexaoxaicosanoic acid
PEG-based research compound for bioconjugation
tert-butyl 4-iodobenzoate
QHHNHUWOOFETNQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=C(C=C1)I