1,4-This compound is a chemical compound used as a pharmaceutical intermediate. It contains ester functional groups and is employed in the synthesis of other compounds for research and manufacturing purposes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1187-74-2
Tert-butyl N-[5-(trifluoromethyl)pyridin-3-yl]carbamate
pharmaceutical intermediate
Methyl (2S)-2-oxiranecarboxylate
chiral building block for synthesis
(S)-(+)-Glycidyl-4-nitrobenzoate
Chiral building block for synthesis
1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-5-ol
Benzoxaborole pharmaceutical intermediate
diethyl 2-(2-oxopropyl)butanedioate
AAPVOVKOHNCXJA-UHFFFAOYSA-N
CCOC(=O)CC(CC(=O)C)C(=O)OCC