This compound is a polychlorinated nitroaniline derivative used as an intermediate in pharmaceutical manufacturing. It features an aromatic ether structure with multiple halogen substituents and an amine group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 118353-04-1
RU Phosphoramidite
RNA oligonucleotide synthesis building block
(R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate
Pharmaceutical intermediate for API synthesis
4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid
pharmaceutical intermediate
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid
protected amino acid for peptide synthesis
4-chloro-5-(2,3-dichlorophenoxy)-2-nitroaniline
WZFITXMPNXRORE-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C(=C2)N)[N+](=O)[O-])Cl