This compound is a salt-like organoboron reagent, typically supplied as a research chemical. Its structure features a pyrazole ring and a boronate ester moiety, making it of interest for organic synthesis and materials science studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1173889-20-7
3-amino-3-(3-bromophenyl)propanoic acid
Research compound
3-amino-3-(3-fluorophenyl)propanoic acid
chemical compound for research
1,1-Dimethylethyl 4-[[[(1R,2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]oct-2-yl]carbonyl]amino]-1-piperidinecarboxylate
research compound
5-Bromo-6-methyl-3-pyridinecarboxaldehyde
synthetic building block for pharmaceutical research
lithium 4-(2-hydroxy-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)-1-methylpyrazole
YAGHQCJCHREQHW-UHFFFAOYSA-N
[Li+].[B-]1(OC(C(O1)(C)C)(C)C)(C2=CN(N=C2)C)O
—