4-Bromobenz-2,3,5,6-d4-aldehyde is a deuterated research reagent, specifically the tetradeuterated form of 4-bromobenzaldehyde in which the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used in scientific research where isotopic labeling is required, such as in mechanistic studies or as an internal standard for analytical chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1173020-64-8
4-Amino-3,5-dichloro-alpha-(((1-(methyl-d3)ethyl-1,2,2,2-d4)amino)methyl)benzenemethanol
Deuterated analytical reference standard
Leucomalachite Green-d6
stable isotope labeled reference standard
Tetramisole-d5 hydrochloride
research reagent
1,3-Difluorobenzene-d4
deuterated research compound
4-Bromobenzaldehyde
Pharmaceutical intermediate
4-bromo-2,3,5,6-tetradeuteriobenzaldehyde
ZRYZBQLXDKPBDU-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Br)[2H]