This compound is a polycyclic aromatic diol featuring two bromine substituents and two 9,9-dimethylfluoren-2-yl groups attached to an anthracene-9,10-diol core. Its structure includes multiple aromatic rings and alcohol functional groups, making it a specialized laboratory reagent for organic synthesis and materials research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1154751-56-0
1-Benzyl-N-phenylpiperidin-4-amine
Research reagent for pharmacological studies
N-Carbobenzoxy-L-glutamic acid
Research compound for peptide synthesis
(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride
pharmaceutical research compound
(1-aminocyclopropyl)methanol hydrochloride
research compound
2,6-dibromo-9,10-bis(9,9-dimethylfluoren-2-yl)anthracene-9,10-diol
DOVVBLFNAFZXLO-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4(C5=C(C=C(C=C5)Br)C(C6=C4C=C(C=C6)Br)(C7=CC8=C(C=C7)C9=CC=CC=C9C8(C)C)O)O)C
—