This compound is a pharmaceutical intermediate featuring a biphenyl core with a bromomethyl substituent and a tert-butyl ester group. It is primarily relevant in the synthesis of advanced pharmaceutical compounds, particularly those targeting the angiotensin II receptor.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 114772-40-6
2-Cyano-4'-methylbiphenyl
pharmaceutical intermediate
4'-Bromomethyl-2-cyanobiphenyl
Pharmaceutical intermediate
Des[2'-(1H-tetrazol-5-yl)] 2-cyanolosartan
Pharmaceutical intermediate for losartan synthesis
2-Chloro-4-fluoro-5-nitrobenzoic acid
pharmaceutical intermediate for bumetanide
tert-butyl 2-[4-(bromomethyl)phenyl]benzoate
YHXCWNQNVMAENQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=CC=C1C2=CC=C(C=C2)CBr