This compound is a deuterium-labeled research reagent, specifically a bromoiodobenzene derivative with four deuterium atoms replacing hydrogen atoms on the aromatic ring. Its primary significance is as a stable isotope-labeled compound used in analytical and synthetic chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1147565-46-5
(R)-O-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)hydroxylamine
organic synthesis intermediate
4,4,5,5-Tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,2-dioxaborolane
Research reagent for synthetic chemistry
Diethyl 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Hantzsch ester as redox probe
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
1-Bromo-4-iodobenzene
research reagent for organic synthesis
1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene
UCCUXODGPMAHRL-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Br)[2H])[2H])I)[2H]