Fmoc-Phe-Lys(Trt)-PAB-PNP is a protected amino acid derivative used as a building block in solid-phase peptide synthesis. Its structure incorporates a Fmoc-protected phenylalanine, a trityl-protected lysine, and a PAB-PNP linker, enabling the construction of complex peptide sequences.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1116086-09-9
3-bromoimidazo[1,2-a]pyridine-8-carboxylic acid
Research compound
Methyl 4-bromocrotonate
research compound
2-Bromo-3-fluoroaniline
Research chemical for synthesis
Magnesium bromide 5-chlorothiophen-2-ide (1/1/1)
5-Chloro-2-thienylmagnesium bromide reagent
[4-[[(2S)-1-amino-1-oxo-6-(tritylamino)hexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
LOGURWMJSNXIEZ-YQOHNZFASA-N
C1=CC=C(C=C1)C[C@@H](C(=O)N(C2=CC=C(C=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])[C@@H](CCCCNC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C(=O)N)NC(=O)OCC7C8=CC=CC=C8C9=CC=CC=C79