This compound is a chiral pharmaceutical intermediate used in the synthesis of Exatecan. It features a complex fused-ring structure with multiple functional groups, including an alcohol, ester, and aromatic ring.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 110351-94-5
((3as,5r,6s,6as)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)(morpholino)methanone
pharmaceutical intermediate
(2-chloro-5-iodophenyl)(4-ethoxyphenyl)methanone
Pharmaceutical intermediate
110428-42-7
steroidal pharmaceutical intermediate
N-Methylparoxetine
Pharmaceutical intermediate for paroxetine
(4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione
IGKWOGMVAOYVSJ-ZDUSSCGKSA-N
CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)O