N-tert-butoxycarbonyl-L-pyroglutamic acid methyl ester is a protected amino acid derivative commonly employed as a pharmaceutical intermediate. Its primary significance lies in its use for peptide synthesis, where the tert-butoxycarbonyl (Boc) group serves as a temporary protecting group for the amine functionality.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 108963-96-8
(R)-Di-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
Di-tert-butyl (2s)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
3-HYDROXYPYRIDINE
pharmaceutical intermediate
1-Methylpiperazine
Pharmaceutical intermediate and fine chemical
4-Methylmorpholine
pharmaceutical intermediate
2-BROMOPYRIDINE
Intermediate for pharmaceuticals and agrochemicals
1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate
FNTAOUUEQHKLIU-ZETCQYMHSA-N
CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OC