2-Bromo-2'-chloro-1,1'-biphenyl is a halogenated biphenyl compound consisting of a bromine atom on one benzene ring and a chlorine atom on the adjacent ring. It has a nonpolar structure with two aromatic rings and one rotatable bond, giving it low polarity and high lipophilicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 107208-70-8
1-bromo-2-(2-chlorophenyl)benzene
JSVXIWLDFVOHBB-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC=CC=C2Br)Cl