Sodium bis(trimethylsilyl)amide is a strong base commonly used in chemical synthesis as a laboratory reagent. It is a salt-like compound composed of a sodium cation and a bis(trimethylsilyl)amide anion, typically handled under inert conditions due to its reactivity with moisture.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1070-89-9
Potassium bis(trimethylsilyl)amide
strong non-nucleophilic base
BrettPhos
phosphine ligand for cross-coupling reactions
2,5-Dimethoxyphenylboronic acid
Research reagent for organic synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
5-bromo-3,4-dimethylbenzene-1,2-diamine
research compound
sodium bis(trimethylsilyl)azanide
WRIKHQLVHPKCJU-UHFFFAOYSA-N
C[Si](C)(C)[N-][Si](C)(C)C.[Na+]