Boc-D-Lys-OH is a protected derivative of D-lysine where the amino group is blocked by a tert-butoxycarbonyl (Boc) group, commonly used as a building block in solid-phase peptide synthesis. Its primary significance lies in enabling the incorporation of D-lysine residues into peptide chains during laboratory-scale and industrial peptide manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 106719-44-2
(2S)-4-amino-2-{[(tert-butoxy)carbonyl]amino}butanoic acid
Protected amino acid building block
BOC-D-DAB-OH
building block in peptide synthesis
Cbz-alanine
peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
(S)-22-(tert-Butoxycarbonyl)-45,45-dimethyl-10,19,24,43-tetraoxo-3,6,12,15,44-pentaoxa-9,18,23-triazahexatetracontanoic acid
peptide synthesis intermediate
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
Acethydrazide
pharmaceutical intermediate
Diethyl acetamidomalonate
Pharmaceutical intermediate for flurbiprofen
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
DQUHYEDEGRNAFO-MRVPVSSYSA-N
CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O