4-Butoxyphenylboronic acid is a boronic acid derivative used as a research chemical. Its structure features an aromatic ring with a butoxy substituent, contributing to its properties for laboratory applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 105365-51-3
4'-Pentyloxybiphenyl-4-boronic Acid
pharmaceutical intermediate
N-Nitroso Cilazapril
Nitrosamine impurity standard
1,2-Dimyristoyl-sn-glycero-3-phospho-L-serine sodium salt
phospholipid research reagent
4-(Methylamino)benzoic acid
research reagent
PRO-LYS-LYS-LYS-ARG-LYS-VAL-GLU-ASP-*PRO-TYR-CYS
research compound
(4-butoxyphenyl)boronic acid
QUPFQMXWFNJUNJ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OCCCC)(O)O