Benzylbis(2-chloroethyl)amine hydrochloride is a chemical compound used as a pharmaceutical intermediate, primarily in the synthesis of nitrogen mustard derivatives. It features a benzyl group and two chloroethyl chains, and is commonly supplied as a hydrochloride salt for manufacturing and research applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 10429-82-0
D-Homoserine Lactone hydrochloride
pharmaceutical intermediate
N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-6-oxo-1H-purin-2-yl]-2-phenylacetamide
Pharmaceutical intermediate for oligonucleotide synthesis
(R)-1-Cbz-3-aminopiperidine
Pharmaceutical intermediate
2-Aminoethylmethylsulfone hydrochloride
pharmaceutical intermediate
N-benzyl-2-chloro-N-(2-chloroethyl)ethanamine;hydrochloride
AZRWNJFEUSHORT-UHFFFAOYSA-N
C1=CC=C(C=C1)CN(CCCl)CCCl.Cl