3,5-Diiodo-L-thyronine is a chemical compound used as a pharmaceutical intermediate in the synthesis of thyroid hormones. It is structurally related to triiodothyronine (T3), a naturally occurring thyroid hormone that influences metabolism, growth, and development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1041-01-6
Levotiroksin
active pharmaceutical ingredient
Tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hemioxalate
Pharmaceutical intermediate
[(4-Chlorobenzoyl)oxy]acetic acid
pharmaceutical intermediate for acemetacin
GCLE
Cephalosporin intermediate for antibiotic synthesis
DODMA
Lipid nanoparticle component for drug delivery
(2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid
ZHSOTLOTTDYIIK-ZDUSSCGKSA-N
C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I