2-Benzamido-4-mercaptobutanoic acid is a research compound featuring a benzamide group linked to a thiol-containing butanoic acid backbone. Its structure includes an amide, a carboxylic acid, and a thiol group, making it useful as a building block in peptide and intermediate synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 103796-22-1
1-Nitrosopiperidin-4-yl)diphenylmethanol
Nitrosamine impurity reference standard
4,4'-Diaminooctafluorobiphenyl
research compound for structural studies
4,4'-Dibromooctafluorobiphenyl
Research compound for crystallography studies
3-(3,4-dichlorophenyl)pentanedioic acid
research compound
2-benzamido-4-sulfanylbutanoic acid
ZQQSNOCMNFNYHN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)NC(CCS)C(=O)O