This compound is a deuterium-labeled derivative of 4-methoxytoluene, used primarily as a research reagent. Its deuterated structure makes it valuable for analytical studies such as mass spectrometry and NMR spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1036431-36-3
3-Methoxyphenylboronic acid
research compound
2-Chloronicotinamide
research compound
(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol
research compound
2-(Trifluoromethyl)pyridine-4-boronic acid, pinacol ester
boronic ester research reagent
4-METHOXYTOLUENE-2,3,5,6-D4
isotope-labeled research standard
1,2,4,5-tetradeuterio-3-methoxy-6-(trideuteriomethyl)benzene
CHLICZRVGGXEOD-HRDWIZOWSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])OC)[2H]