Leupeptin hemisulfate is a peptide sulfate salt consisting of leupeptin with half an equivalent of sulfuric acid. It functions as a serine protease inhibitor and is used as a research reagent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 103476-89-7
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-D-leucine
Fmoc-protected amino acid for peptide synthesis
Quinoline-6-carboxylic acid
research compound
[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride
catalyst for cross-coupling reactions
2-Bromothiazolo[5,4-c]pyridin-4(5H)-one
Research compound for chemical synthesis
bis((2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide);sulfuric acid
CIPMKIHUGVGQTG-VFFZMTJFSA-N
CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.OS(=O)(=O)O