GTP TRIS SALT is a salt form of guanosine triphosphate, commonly used as a nucleotide research reagent in biochemical and molecular biology studies. Its structure includes a triphosphate group and a guanine base, making it a key compound for investigating cellular signaling and energy transfer processes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 103192-46-7
GUANOSINE TRIPHOSPHATE
n.a
Guanosine 5'-diphosphate
nucleotide metabolite and intermediate
Diguanosine triphosphate
research reagent for enzymology studies
Guanosine 5'-triphosphate-5'-adenosine
Nucleoside polyphosphate research reagent
Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt
nucleotide research reagent
Cytidine-5'-O-(1-thiotriphosphate)
nucleotide research reagent
143028-98-2 (free acid)
nucleotide research reagent
ATP dimagnesium salt
nucleotide research reagent
2-amino-2-(hydroxymethyl)propane-1,3-diol;[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
ZRZRJQPUFRIVGW-GWTDSMLYSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N.C(C(CO)(CO)N)O