This compound is a pharmaceutical intermediate featuring a chiral center, an aromatic ring, and a chlorinated ketone moiety. It is primarily used as a building block in the synthesis of peptide-related compounds and other pharmaceutical agents.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 102123-74-0
1-(cyclopropylcarbonyl)piperazine hydrochloride
pharmaceutical intermediate
2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzonitrile
pharmaceutical intermediate
(2R)-N-(2-Benzoyl-4-chlorophenyl)-1-(phenylmethyl)-2-pyrrolidinecarboxamide Hydrochloride
Pharmaceutical intermediate for diazepam impurity
Boc-Arg(Mtr)-OH
protected arginine derivative for peptide synthesis
tert-butyl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate
JAKDNFBATYIEIE-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)CCl