This compound is a deuterium-labeled derivative of a piperidine-based building block, specifically tert-butyl 4-oxopiperidine-1-carboxylate. It is used as a research reagent, primarily in life science and chemical studies where isotopic labeling aids in tracking or mechanistic investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1014695-53-4
C7-Gdtp
Nucleotide analog for biochemical research
N-(9-Fluorenylmethoxycarbonyl)-D-proline
Fmoc-protected amino acid for peptide synthesis
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
4,4,5-trideuterio-5-[dideuterio(morpholin-4-yl)methyl]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one
deuterated internal standard for veterinary drug residue analysis
Tert-Butyl 4-Oxopiperidine-1-carboxylate
Pharmaceutical intermediate for synthesis
Tert-Butyl 3-methoxy-4-oxopiperidine-1-carboxylate
pharmaceutical intermediate
1-Methyl-4-piperidone-2,2,6,6-d4
deuterated research reference standard
Tert-Butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate
Pharmaceutical intermediate for API synthesis
tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate
ROUYFJUVMYHXFJ-KXGHAPEVSA-N
[2H]C1(CC(=O)CC(N1C(=O)OC(C)(C)C)([2H])[2H])[2H]