6-Chloro-5-nitro-1H-indazole is a chemical compound used as a pharmaceutical intermediate. It features a heterocyclic indazole core with chlorine and nitro substituents, which makes it a building block in the synthesis of more complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 101420-98-8
Tert-butyl (3S)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
pharmaceutical intermediate
Hydroxy Dimetridazole-d3
Pharmaceutical intermediate and reference standard
N-(2-(Dimethylamino)-3-methylbutyl)-4-(((4-methyl-2-oxo-2H-chromen-7-yl)oxy)methyl)benzamide
pharmaceutical intermediate
6-chloro-5-nitro-1H-indazole
SXVCMKGCWGVSSX-UHFFFAOYSA-N
C1=C2C=NNC2=CC(=C1[N+](=O)[O-])Cl