This compound is an anionic naphthalene sulfonate salt used as a fluorescent probe and assay reagent in biochemical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 100900-07-0
N1-(4-bromophenyl)-1,2-benzenediamine
research compound
2-BENZYLPYRIDINE
inducer of hepatic microsomal cytochrome P450
(6-Phenyldibenzo[b,d]furan-4-yl)boronic acid
Boronic acid building block for synthesis
2-Chloro-5-thiazolecarboxylic acid
research compound for synthetic chemistry
sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate
HGWRACRQRUQQGH-UHFFFAOYSA-M
C1=CC2=C(C=CC=C2S(=O)(=O)[O-])C(=C1)NCCN.[Na+]