Fructosylvaline is a small-molecule research compound belonging to the class of fructosamines, formed through the non-enzymatic glycation of the amino acid valine with fructose. It is primarily used as a standard or reference material in studies investigating the Maillard reaction and advanced glycation end-products (AGEs) in food chemistry and biomedical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 10003-64-2
3-Fluoro-2-nitrobenzoic acid
research compound
3,5-dibromo-2-fluoro-4-methylpyridine
research compound
3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Research reagent
1,4-Piperazinediethanesulfonic acid sesquisodium salt
buffering agent in biochemistry
(2S)-3-methyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid
JEQHVKBNRPNQDY-UTINFBMNSA-N
CC(C)[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O