4-Nitrophenol is a phenolic compound with a nitro group positioned opposite the hydroxyl group on the benzene ring. It serves as an intermediate in the production of insecticides and dyes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 100-02-7
4-Nitrobenzyl chloride
chemical intermediate for synthesis
Terephthaloyl chloride
Intermediate for synthetic fibers and resins
2-(Diethylamino)ethanol
chemical intermediate for pharmaceuticals and industrial chemicals
Phenylethane
intermediate for styrene production
Sodium 4-nitrophenolate
Intermediate for pesticide production
Phen-2,3,5,6-d4-ol, 4-nitro-
deuterated research compound
4-nitrophenol
BTJIUGUIPKRLHP-UHFFFAOYSA-N
C1=CC(=CC=C1[N+](=O)[O-])O