N-Carbobenzyloxy-D-serine-beta-lactone is a chemical compound used as a pharmaceutical intermediate. It features a beta-lactone ring and a carbobenzyloxy protecting group, making it suitable for the synthesis of more complex pharmaceutical compounds.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 98632-91-8
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
Cbz-D-Homoserine lactone
research compound
(2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane
pharmaceutical intermediate for protease inhibitors
1-bromo-2-methoxy-3-nitrobenzene
Pharmaceutical intermediate for research
Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
nucleoside phosphoramidite for oligonucleotide synthesis
Adenosine, N-benzoyl-5'-O-(bis(4-methoxyphenyl)phenylmethyl)-2'-deoxy-, 3'-(2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite)
phosphoramidite for oligonucleotide synthesis
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
benzyl N-[(3R)-2-oxooxetan-3-yl]carbamate
CWFZPRQDHIUBDO-SECBINFHSA-N
C1[C@H](C(=O)O1)NC(=O)OCC2=CC=CC=C2