Benzhydryl chloride is a chlorinated organic compound consisting of a diphenylmethyl structure with a chlorine atom attached to the central carbon. It is primarily used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 90-99-3
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
Ethyl ((1R,3aR,4aR,6R,8aR,9S,9aS)-9-(diphenylcarbamoyl)-1-methyl-3-oxododecahydronaphtho[2,3-c]furan-6-yl)carbamate
pharmaceutical intermediate
(3R,3aR,4S,4aR,7R,8aR,9aR)-7-((Ethoxycarbonyl)amino)-3-methyl-1-oxododecahydronaphtho[2,3-c]furan-4-carboxylic acid
Pharmaceutical intermediate
2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol
pharmaceutical excipient and coating agent
Ethylene glycol monostearate
surfactant and emulsifier in pharmaceuticals
[chloro(phenyl)methyl]benzene
ZDVDCDLBOLSVGM-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl