BippyPhos is a bipyrazole ligand used in research as a reagent for coordination chemistry and catalysis. Its structure features a phosphine group attached to a bipyrazole core with multiple aromatic rings, contributing to its role in organometallic studies.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 894086-00-1
(2-hydroxyphenyl)boronic Acid
chemical building block for boronic acid reactions
6-bromo-2-methoxypyridin-3-amine
research reagent
2-Bromo-4-methoxypyridine
Research reagent
1-cyclohexenylboronic Acid
research compound
ditert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane
PTXJGGGNGMPMBG-UHFFFAOYSA-N
CC(C)(C)P(C1=CC=NN1C2=C(N(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C(C)(C)C