2'-Hydroxy[1,1'-biphenyl]-3-carboxylic acid is a biphenyl derivative featuring a carboxylic acid and a hydroxyl group on adjacent aromatic rings. It is used as a research reagent in studies related to transthyretin, a transport protein that carries thyroxine and retinol in blood and cerebrospinal fluid.
Область применения: Информация на этой странице относится к идентификации химических веществ и к контекстам промышленного снабжения, исследований и производства. Она не является терапевтическим заявлением, медицинской рекомендацией или инструкцией по применению лекарственных средств.
Закупаете или поставляете это соединение?
Разместите инвентарь или запрос на покупку
CAS 893736-72-6
Thiazole-2,4-dicarboxylic acid
research compound for chemical synthesis
2-Cyclopropylethanamine hydrochloride
research compound
(2r)-1-(benzyloxy)propan-2-ol
research compound
(S)-3-(1-(Dimethylamino)ethyl)phenol hydrochloride
research compound
3-(2-hydroxyphenyl)benzoic acid
OCZVWZVTEQXRPI-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC(=CC=C2)C(=O)O)O